A1209612
2-Biphenylboronic acid , 97% , 4688-76-0
CAS NO.：4688-76-0
Empirical Formula: C12H11BO2
Molecular Weight: 198.03
MDL number: MFCD00136929
EINECS: 670-315-1
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB104.80 | In Stock |
|
| 25G | RMB316.80 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 167-172 °C (lit.) |
| Boiling point: | 404.0±38.0 °C(Predicted) |
| Density | 1.18 |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 8.50±0.58(Predicted) |
| form | Powder or Low Melting Solid |
| color | White to yellow |
| Water Solubility | Insoluble in water. |
| λmax | 250nm(CH2Cl2)(lit.) |
| BRN | 3031806 |
| InChI | InChI=1S/C12H11BO2/c14-13(15)12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-9,14-15H |
| InChIKey | HYCYKHYFIWHGEX-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C1=CC=CC=C1)(O)O |
Description and Uses
Reactant involved in:
- Suzuki-Miyaura cross-coupling reactions with arylhalides, dibromovinyl precursors, alkenyl tosylates and mesylates, and quinoline carboxylates
- Intramolecular Friedel-Crafts alkylation for synthesis of chiral tetralins
- Hydroxylation to phenols
- Oxidative coupling iwth alkynes
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P264-P280-P302+P352+P332+P313+P362+P364-P305+P351+P338+P337+P313-P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| Hazard Codes | C,Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36-60-37 |
| WGK Germany | 3 |
| Hazard Note | Corrosive |
| HazardClass | IRRITANT |
| HS Code | 29310095 |
