A1200312
1,4-Bis(dimethylsilyl)benzene , 97% , 2488-01-9
Synonym(s):
p-Phenylenebis(dimethylsilane)
CAS NO.：2488-01-9
Empirical Formula: C10H18Si2
Molecular Weight: 194.42
MDL number: MFCD00039790
EINECS: 219-638-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB39.20 | In Stock |
|
| 5G | RMB63.20 | In Stock |
|
| 10g | RMB119.20 | In Stock |
|
| 25G | RMB284.00 | In Stock |
|
| 100G | RMB1084.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 115 °C |
| Boiling point: | 213-214 °C(lit.) |
| Density | 0.874 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 185 °F |
| storage temp. | Inert atmosphere,Room Temperature |
| form | clear liquid |
| Specific Gravity | 0.872 |
| color | Colorless to Light yellow |
| Hydrolytic Sensitivity | 3: reacts with aqueous base |
| BRN | 1072658 |
| InChI | InChI=1S/C10H18Si2/c1-11(2)9-5-7-10(8-6-9)12(3)4/h5-8,11-12H,1-4H3 |
| InChIKey | KQERVIARWMHFOS-UHFFFAOYSA-N |
| SMILES | C1([SiH](C)C)=CC=C([SiH](C)C)C=C1 |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H227-H302-H313-H315-H319-H335 |
| Precautionary statements | P210e-P261-P280a-P305+P351+P338-P405-P501a |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Safety Statements | 26-36/37/39-36/37-23 |
| RIDADR | 1993 |
| WGK Germany | 3 |
| RTECS | VV4830000 |
| TSCA | Yes |
| HS Code | 29319000 |
