A1199712
2,2-Bis(3-amino-4-hydroxyphenyl)hexafluoropropane , 98% , 83558-87-6
CAS NO.：83558-87-6
Empirical Formula: C15H12F6N2O2
Molecular Weight: 366.26
MDL number: MFCD00039147
EINECS: 617-475-0
| Pack Size | Price | Stock | Quantity |
| 5G | RMB30.40 | In Stock |
|
| 25G | RMB104.80 | In Stock |
|
| 100G | RMB366.40 | In Stock |
|
| 500g | RMB1533.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 245-248 °C (lit.) |
| Boiling point: | 411.3±45.0 °C(Predicted) |
| Density | 1.545±0.06 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | 9.07±0.10(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChI | InChI=1S/C15H12F6N2O2/c16-14(17,18)13(15(19,20)21,7-1-3-11(24)9(22)5-7)8-2-4-12(25)10(23)6-8/h1-6,24-25H,22-23H2 |
| InChIKey | MSTZGVRUOMBULC-UHFFFAOYSA-N |
| SMILES | C(C1=CC=C(O)C(N)=C1)(C1=CC=C(O)C(N)=C1)(C(F)(F)F)C(F)(F)F |
Description and Uses
2,2-bis(3-amino-4-hydroxyphenyl)hexafluoropropane（BisAPAF） is a polyimide monomer.It is mairly used in the aynthesis of the heat resisting polymers,especially in the manufacture of specialty polymeoric electronic material-fluorinated polyimides.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29222990 |
