A1185512
Boc-N-Me-Val-OH , 98% , 45170-31-8
Synonym(s):
Boc-N-methyl-L -valine;Boc-N-Me-Val-OH;N-α-t.-Boc-N-α-methyl-L-valine
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB23.20 | In Stock |
|
| 1G | RMB35.20 | In Stock |
|
| 5G | RMB110.40 | In Stock |
|
| 25g | RMB428.00 | In Stock |
|
| 100g | RMB1609.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 45-60°C |
| alpha | -94 º (c=0.5% in ethanol) |
| Boiling point: | 322.4±21.0 °C(Predicted) |
| Density | 1.069±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Ethanol (Slightly), Methanol (Slightly) |
| form | Solid |
| pka | 4.03±0.10(Predicted) |
| color | Off-White |
| optical activity | [α]20/D 94±3°, c = 0.5% in ethanol |
| BRN | 2646180 |
| InChI | InChI=1S/C11H21NO4/c1-7(2)8(9(13)14)12(6)10(15)16-11(3,4)5/h7-8H,1-6H3,(H,13,14)/t8-/m0/s1 |
| InChIKey | XPUAXAVJMJDPDH-QMMMGPOBSA-N |
| SMILES | C(O)(=O)[C@H](C(C)C)N(C(OC(C)(C)C)=O)C |
Description and Uses
N-Boc-N-methyl-L-valine (Boc-N-Me-Val-OH) is an amino acid derived compound that functions as a useful pharmaceutical intermediate and also employed as a reagent used in organic synthesis. It is used in the synthesis of lactam analog of actinomycin D, a potential antitumor chemotherapeutic agent. It is also used to N-tert-Butoxycarbonyl-N-methyl-L-valine 4-ethynylanilide with 4-ethynylaniline[1].
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29225090 |
