MonoMethylauristatinE , 97% , 474645-27-7
| Pack Size | Price | Stock | Quantity |
| 5mg | RMB223.20 | In Stock |
|
| 10mg | RMB399.20 | In Stock |
|
| 25mg | RMB639.20 | In Stock |
|
| 50mg | RMB799.20 | In Stock |
|
| 100mg | RMB1279.20 | In Stock |
|
| 250mg | RMB2399.20 | In Stock |
|
| others | Enquire |
PRODUCT Properties
| Melting point: | >90°C (dec.) |
| Boiling point: | 873.5±65.0 °C(Predicted) |
| Density | 1.088±0.06 g/cm3(Predicted) |
| storage temp. | -20°C Freezer |
| solubility | DMSO (Slightly), Methanol (Slightly, Sonicated) |
| pka | 13.66±0.20(Predicted) |
| form | Solid |
| color | White to Off-White |
| InChIKey | RJACXSRFJLSJEZ-UIJRFTGLSA-N |
| SMILES | C(NC(=O)[C@H](C(C)C)NC)(=O)[C@H](C(C)C)N([C@@H]([C@@H](C)CC)[C@H](OC)CC(N1CCC[C@H]1[C@H](OC)[C@@H](C)C(N[C@H](C)[C@@H](O)C1=CC=CC=C1)=O)=O)C |
Description and Uses
MMAE is a synthetic antineoplastic agent. Because of its toxicity, it cannot be used as a drug itself; instead, it is linked to a monoclonal antibody (MAB) which directs it to the cancer cells. Monomethyl auristatin E or MMAE is 100-1000 times more potent than doxorubicin. It is a very potent antimitotic agent that inhibits cell division by blocking the polymerization of tubulin.
Dolastatin 10 is a natural antimitotic and antineoplastic agent that binds to tubulin and inhibits tubulin polymerization. Monomethyl Auristatin E (MMAE) is a synthetic analog of dolastatin 10 that similarly inhibits tubulin polymerization and exhibits potent cytotoxicity. It is commonly conjugated with monoclonal antibodies directed at antigens specific to cancer cells for tumor-directed cytotoxicity. MMAE is typically coupled to the antibody via a protease-cleavable linker, allowing separation of the drug from the antibody following intracellular localization.[Cayman Chemical]
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
