A0898750
RutheniumAcetate , 99% , 72196-32-8
| Pack Size | Price | Stock | Quantity |
| 250mg | RMB207.20 | In Stock |
|
| 1g | RMB559.20 | In Stock |
|
| 5g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| storage temp. | Inert atmosphere,Room Temperature |
| InChI | InChI=1S/C2H4O2.Ru/c1-2(3)4;/h1H3,(H,3,4); |
| InChIKey | SPDCFZAAMSXKTK-UHFFFAOYSA-N |
| SMILES | C(=O)(O)C.[Ru] |
Description and Uses
Ruthenium Acetate is a moderately water-soluble crystalline Ruthenium source that decomposes to Ruthenium oxide on heating. Ruthenium Acetate is a coordination compound. It consists of three ruthenium atoms connected by acetate ligands. This compound is known for its applications in catalysis, particularly in organic synthesis reactions such as hydrogenation, carbonylation, and oxidation processes. Ruthenium acetate can also be used to prepare other ruthenium complexes and materials.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P264-P270-P301+P310-P321-P330-P405-P501 |
