A0890212
4'-Amino-3',5'-dichloroacetophenone , >98.0%(GC) , 37148-48-4
Synonym(s):
1-(4-Amino-3,5-dichlorophenyl)-ethanone;3,5-Dichloro-4-aminoacetophenone
CAS NO.：37148-48-4
Empirical Formula: C8H7Cl2NO
Molecular Weight: 204.05
MDL number: MFCD00238535
EINECS: 253-368-1
| Pack Size | Price | Stock | Quantity |
| 5G | RMB40.00 | In Stock |
|
| 25G | RMB151.20 | In Stock |
|
| 100g | RMB607.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 162-166 °C(lit.) |
| Boiling point: | 351.5±42.0 °C(Predicted) |
| Density | 1.2748 (rough estimate) |
| refractive index | 1.5500 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| pka | -1.72±0.10(Predicted) |
| form | Solid |
| color | Light Tan to Brown |
| InChI | InChI=1S/C8H7Cl2NO/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,11H2,1H3 |
| InChIKey | JLPKZJDZXIKSCP-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC(Cl)=C(N)C(Cl)=C1)C |
Description and Uses
4-Amino-3,5-dichloroacetophenone is used to synthesize the drug Clenbuterol. Clenbuterol is a steroid-like chemical that was initially developed to treat asthma in horses, working by relaxing the airways in the animals'lungs.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36-37/39 |
| WGK Germany | 3 |
| HS Code | 29223990 |
