A0872050
Pyridinetrifluoroacetate , 98% , 464-05-1
Synonym(s):
Trifluoroacetic acid pyridine salt
CAS NO.：464-05-1
Empirical Formula: C7H6F3NO2
Molecular Weight: 193.12
MDL number: MFCD00013072
EINECS: 207-345-8
| Pack Size | Price | Stock | Quantity |
| 5g | RMB40.80 | In Stock |
|
| 25g | RMB149.60 | In Stock |
|
| 100g | RMB397.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 83-86 °C (lit.) |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | water: soluble5%, clear, colorless |
| form | Solid |
| color | White to Off-White |
| BRN | 3735993 |
| Stability: | Hygroscopic |
| InChI | InChI=1S/C5H5N.C2HF3O2/c1-2-4-6-5-3-1;3-2(4,5)1(6)7/h1-5H;(H,6,7) |
| InChIKey | NRTYMEPCRDJMPZ-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(=O)O.C1=CC=NC=C1 |
Description and Uses
Pyridine Trifluoroacetate may be used as a catalyst, coupling agent or reacting solvent.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| F | 3-10 |
| HS Code | 2933399990 |
