A0850412
3-Amino-<i>o</i>-cresol , 98% , 53222-92-7
Synonym(s):
3-Amino-o-cresol
CAS NO.：53222-92-7
Empirical Formula: C7H9NO
Molecular Weight: 123.15
MDL number: MFCD00007787
EINECS: 258-438-5
| Pack Size | Price | Stock | Quantity |
| 1g | RMB194.40 | In Stock |
|
| 5G | RMB536.00 | In Stock |
|
| 25G | RMB2476.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 129-130 °C(lit.) |
| Boiling point: | 229.26°C (rough estimate) |
| Density | 1.0877 (rough estimate) |
| refractive index | 1.5380 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| pka | 10.36±0.10(Predicted) |
| form | Solid |
| color | White to Gray to Brown |
| InChI | InChI=1S/C7H9NO/c1-5-6(8)3-2-4-7(5)9/h2-4,9H,8H2,1H3 |
| InChIKey | FLROJJGKUKLCAE-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=CC(N)=C1C |
Description and Uses
3-Amino-2-methylphenol is used in production of (Diimido)dicarboxylic Acid, Imide, Polyamic Acid, Polyamides, Polyesters, and Polyureas.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P280a-P304+P340-P405-P501a-P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 29222900 |
