A0843112
1-Acetyladamantane , >98.0%(GC) , 1660-04-4
CAS NO.：1660-04-4
Empirical Formula: C12H18O
Molecular Weight: 178.27
MDL number: MFCD00074739
EINECS: 216-761-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB48.00 | In Stock |
|
| 25G | RMB171.20 | In Stock |
|
| 100G | RMB655.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 53-55 °C (lit.) |
| Boiling point: | 250.52°C (rough estimate) |
| Density | 0.9172 (rough estimate) |
| refractive index | 1.5050 (estimate) |
| Flash point: | 227 °F |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | Chloroform (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| color | White |
| Water Solubility | Soluble in methanol- very faint turbidity. Insoluble in water. |
| InChI | InChI=1S/C12H18O/c1-8(13)12-5-9-2-10(6-12)4-11(3-9)7-12/h9-11H,2-7H2,1H3 |
| InChIKey | DACIGVIOAFXPHW-UHFFFAOYSA-N |
| SMILES | C(=O)(C12CC3CC(CC(C3)C1)C2)C |
Description and Uses
1-Adamantyl methyl ketone, is used as an important raw material and intermediate used in organic Synthesis, pharmaceuticals, agrochemicals and dyestuff.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 24/25-36-26 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HS Code | 29142990 |
