A0841712
2-Amino-6-fluorobenzothiazole , ≥97.0% , 348-40-3
CAS NO.：348-40-3
Empirical Formula: C7H5FN2S
Molecular Weight: 168.19
MDL number: MFCD00013336
EINECS: 609-034-6
| Pack Size | Price | Stock | Quantity |
| 1G | RMB43.20 | In Stock |
|
| 5G | RMB113.60 | In Stock |
|
| 25G | RMB447.20 | In Stock |
|
| 100G | RMB1199.20 | In Stock |
|
| 500G | RMB5119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 183-185 °C (lit.) |
| Boiling point: | 312.0±34.0 °C(Predicted) |
| Density | 1.3490 (estimate) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Crystalline Powder |
| pka | 3.77±0.10(Predicted) |
| color | Off-white to tan |
| InChI | InChI=1S/C7H5FN2S/c8-4-1-2-5-6(3-4)11-7(9)10-5/h1-3H,(H2,9,10) |
| InChIKey | CJLUXPZQUXVJNF-UHFFFAOYSA-N |
| SMILES | S1C2=CC(F)=CC=C2N=C1N |
| CAS DataBase Reference | 348-40-3(CAS DataBase Reference) |
Description and Uses
2-Amino-6-fluorobenzothiazole is a useful research chemical. An intermediate for the synthesis of benzothiazoles and aminobenzothiazoles with antimicrobial activity.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-22 |
| Safety Statements | 26-37/39-36/37/39 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29342000 |
