A0832212
Atipamezole Hydrochloride , 98% , 104075-48-1
CAS NO.：104075-48-1
Empirical Formula: C14H16N2.HCl
Molecular Weight: 248.75
MDL number: MFCD06407819
EINECS: 105-700-9
| Pack Size | Price | Stock | Quantity |
| 25MG | RMB79.20 | In Stock |
|
| 100MG | RMB234.40 | In Stock |
|
| 250MG | RMB252.00 | In Stock |
|
| 1G | RMB827.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 211-215° |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Slightly) |
| form | Solid |
| color | White to Off-White |
| Merck | 14,861 |
| InChI | InChI=1S/C14H16N2.ClH/c1-2-14(13-9-15-10-16-13)7-11-5-3-4-6-12(11)8-14;/h3-6,9-10H,2,7-8H2,1H3,(H,15,16);1H |
| InChIKey | PCCVCJAQMHDWJY-UHFFFAOYSA-N |
| SMILES | C1(CC)(CC2=C(C=CC=C2)C1)C1=CNC=N1.Cl |
| CAS DataBase Reference | 104075-48-1(CAS DataBase Reference) |
Description and Uses
Atipamezole Hydrochloride, is the a synthetic α2-adrenergic antagonist, usually used to reverse the sedative and analgesic effects of dexmedetomidine and medetomidine in dogs. It has also been shown to be used as possible anti-Parkinsonian drug in humans.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H332-H312-H302 |
| Precautionary statements | P261-P271-P304+P340-P312-P264-P270-P301+P312-P330-P501-P280-P302+P352-P312-P322-P363-P501 |
| RTECS | NI6139000 |
| HS Code | 2933.29.2000 |
| Toxicity | LD50 in male, female rats (mg/kg): >50, 44 s.c. (Scheinin) |
