A0810912
3-Amino-4-fluorophenol , 98% , 62257-16-3
CAS NO.：62257-16-3
Empirical Formula: C6H6FNO
Molecular Weight: 127.12
MDL number: MFCD09033850
EINECS: 690-814-8
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB31.20 | In Stock |
|
| 1G | RMB48.80 | In Stock |
|
| 5G | RMB174.24 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 141-143 °C |
| Boiling point: | 269.3±20.0 °C(Predicted) |
| Density | 1.347±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Sealed in dry,Room Temperature |
| form | crystalline powder |
| pka | 10.03±0.18(Predicted) |
| color | Light tan |
| InChI | InChI=1S/C6H6FNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2 |
| InChIKey | VJCSFNNTQGRAKH-UHFFFAOYSA-N |
| SMILES | C1(O)=CC=C(F)C(N)=C1 |
Description and Uses
3-amino-4-fluorophenol is a kind of organic chemistry intermediate commonly used as the intermediate for synthesizing compounds of liquid crystals, pharmaceutical compounds and agricultural chemical compounds used always.
3-Amino-4-fluorophenol is used to produce drugs with specific biological activities, including antibiotics and anti-inflammatory agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302 |
| Precautionary statements | P280-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22 |
| Hazard Note | Toxic |
| HS Code | 2922290090 |
