A0780312
5-Aminonicotinic acid , 98% , 24242-19-1
Synonym(s):
5-Aminonicotinic acid
CAS NO.：24242-19-1
Empirical Formula: C6H6N2O2
Molecular Weight: 138.12
MDL number: MFCD00129116
EINECS: 625-282-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB39.20 | In Stock |
|
| 5G | RMB79.20 | In Stock |
|
| 25G | RMB295.20 | In Stock |
|
| 100G | RMB1119.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 293 °C |
| Boiling point: | 253.51°C (rough estimate) |
| Density | 1.3471 (rough estimate) |
| refractive index | 1.5100 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| pka | 2.36±0.10(Predicted) |
| form | Crystalline Powder |
| color | Golden-brown |
| BRN | 115848 |
| InChI | InChI=1S/C6H6N2O2/c7-5-1-4(6(9)10)2-8-3-5/h1-3H,7H2,(H,9,10) |
| InChIKey | BYIORJAACCWFPU-UHFFFAOYSA-N |
| SMILES | C1=NC=C(N)C=C1C(O)=O |
| CAS DataBase Reference | 24242-19-1(CAS DataBase Reference) |
Description and Uses
5-Aminonicotinic acid is used in the synthesis of coordination polymers, bioluminescent reagents and biological active agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P312-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 36/37/38-20/21/22-22 |
| Safety Statements | 36/37/39-26-36 |
| WGK Germany | 3 |
| HazardClass | IRRITANT |
| HS Code | 29333990 |
