A0759612
(R)-3-Aminobutanol , 98% , 61477-40-5
CAS NO.：61477-40-5
Empirical Formula: C4H11NO
Molecular Weight: 89.14
MDL number: MFCD13184351
EINECS: 640-387-9
| Pack Size | Price | Stock | Quantity |
| 1G | RMB24.00 | In Stock |
|
| 5G | RMB39.20 | In Stock |
|
| 25G | RMB111.20 | In Stock |
|
| 100g | RMB399.20 | In Stock |
|
| 500g | RMB1839.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 168℃ |
| Density | 0.927 |
| refractive index | 1.4530 to 1.4570 |
| Flash point: | 56℃ |
| storage temp. | under inert gas (nitrogen or Argon) at 2–8 °C |
| solubility | soluble in Dichloromethane, DMSO |
| form | clear liquid |
| pka | 15.00±0.10(Predicted) |
| color | Colorless to Light orange to Yellow |
| InChI | InChI=1S/C4H11NO/c1-4(5)2-3-6/h4,6H,2-3,5H2,1H3/t4-/m1/s1 |
| InChIKey | AGMZSYQMSHMXLT-SCSAIBSYSA-N |
| SMILES | C(O)C[C@H](N)C |
| CAS DataBase Reference | 61477-40-5 |
Description and Uses
(R)-3-AMINO-1-BUTANOL is an alcohol organic compound, which is a key intermediate for many chiral drugs.
(R)-3-Aminobutan-1-ol, can be used as an intermediate in the preparation of compounds having HIV integrase inhibitory activity.
Safety
| Symbol(GHS) |   GHS05,GHS02 |
| Signal word | Danger |
| Hazard statements | H314-H226 |
| Precautionary statements | P501-P240-P210-P233-P243-P241-P242-P264-P280-P370+P378-P303+P361+P353-P301+P330+P331-P363-P304+P340+P310-P305+P351+P338+P310-P403+P235-P405 |
| RIDADR | 2735 |
| HS Code | 2922.19.9690 |
| HazardClass | 8 |
| PackingGroup | Ⅲ |
