A0746012
Ala-Tyr , ≥98.0%(HPLC) , 3061-88-9
CAS NO.：3061-88-9
Empirical Formula: C12H16N2O4
Molecular Weight: 252.27
MDL number: MFCD00038164
EINECS: 221-305-7
| Pack Size | Price | Stock | Quantity |
| 100MG | RMB31.20 | In Stock |
|
| 1G | RMB165.60 | In Stock |
|
| 5g | RMB584.80 | In Stock |
|
| 25g | RMB1995.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 238-240℃ (decomposition) |
| Boiling point: | 558.0±50.0 °C(Predicted) |
| Density | 1.315±0.06 g/cm3(Predicted) |
| vapor pressure | 0Pa at 25℃ |
| refractive index | 22 ° (C=2, 5mol/L HCl) |
| storage temp. | -20°C |
| solubility | almost transparency in 5mol/L HCl |
| form | powder to crystal |
| pka | 3.03±0.10(Predicted) |
| color | White to Almost white |
| Water Solubility | 17.99g/L at 20℃ |
| InChI | InChI=1S/C12H16N2O4/c1-7(13)11(16)14-10(12(17)18)6-8-2-4-9(15)5-3-8/h2-5,7,10,15H,6,13H2,1H3,(H,14,16)(H,17,18)/t7-,10-/m0/s1 |
| InChIKey | ALZVPLKYDKJKQU-XVKPBYJWSA-N |
| SMILES | C(O)(=O)[C@H](CC1=CC=C(O)C=C1)NC(=O)[C@H](C)N |
| LogP | -0.31 at 25℃ |
| CAS DataBase Reference | 3061-88-9(CAS DataBase Reference) |
Description and Uses
L-Alanyl-L-tyrosine is used as a tyrosin source in intravenous nutrition of the rate.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P280-P305+P351+P338 |
| WGK Germany | 3 |
| HS Code | 2924.29.7790 |
