A0719956
4-(1-Naphthyl)benzeneboronicacid , 98% , 870774-25-7
CAS NO.：870774-25-7
Empirical Formula: C16H13BO2
Molecular Weight: 248.08
MDL number: MFCD08669639
EINECS: 678-309-0
| Pack Size | Price | Stock | Quantity |
| 1g | RMB28.00 | In Stock |
|
| 5g | RMB111.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 449.4±48.0 °C(Predicted) |
| Density | 1.23±0.1 g/cm3(Predicted) |
| storage temp. | under inert gas (nitrogen or Argon) at 2-8°C |
| solubility | soluble in Tetrahydrofuran |
| form | powder to crystal |
| pka | 8.58±0.16(Predicted) |
| color | White to Light yellow |
| InChI | InChI=1S/C16H13BO2/c18-17(19)14-10-8-13(9-11-14)16-7-3-5-12-4-1-2-6-15(12)16/h1-11,18-19H |
| InChIKey | BQHVXFQXTOIMQM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C2=C3C(C=CC=C3)=CC=C2)C=C1)(O)O |
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P280a-P304+P340-P305+P351+P338-P405-P501a |
| HS Code | 2931900090 |
