A0702512
Aminophylline hydrate , Medicinal grade , 317-34-0
Synonym(s):
(Theophylline)2 · Ethylenediamine;3,7-Dihydro-1,3-dimethyl-1H-purine-2,6-dione, cmpd. with 1,2-ethanediamine (2:1);Theophylline hemi(ethylenediamine) complex
CAS NO.：317-34-0
Empirical Formula: C9H16N6O2
Molecular Weight: 240.27
MDL number: MFCD00013221
EINECS: 206-264-5
| Pack Size | Price | Stock | Quantity |
| 25g | RMB95.20 | In Stock |
|
| 100g | RMB271.20 | In Stock |
|
| 500G | RMB959.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 269-270 °C |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| solubility | H2O: 3.7 mg/mL solutions should be freshly prepared. |
| form | powder |
| pka | pKa 5.0 (Uncertain) |
| color | white to off-white |
| Water Solubility | soluble |
| Merck | 14,465 |
| InChI | InChI=1S/C7H8N4O2.C2H8N2/c1-10-5-4(8-3-9-5)6(12)11(2)7(10)13;3-1-2-4/h3H,1-2H3,(H,8,9);1-4H2 |
| InChIKey | LHRHXWBJUQKYEL-UHFFFAOYSA-N |
| SMILES | O=C1N(C(=O)N(C)C2NC=NC1=2)C.C(N)CN |
| LogP | -0.175 (est) |
Description and Uses
Aminophylline is a 2/1 mixture of theophylline and ethylenediamine. It caused contact dermatitis in industrial plants, in pharmacists, and in nurses. Ethylenediamine is the sensitizer, and patch testing is generally positive to both ethylenediamine and aminophylline, but negative to theophylline.
Bronchodilatator;Mastocytes degranulation inhibitor
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301 |
| Precautionary statements | P301+P310 |
| Hazard Codes | Xn,C |
| Risk Statements | 22-42/43-34-36/37/38-20/21/22 |
| Safety Statements | 45-36/37/39-26-23-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | XH5600000 |
| F | 10-23 |
| TSCA | Yes |
| HazardClass | 6.1(b) |
| PackingGroup | III |
| HS Code | 29339900 |
| Toxicity | LD50 orally in mice: 540 mg/kg (Thompson, Warren) |
