A0682312
2-Amino-5-bromobenzoic acid , 99% , 5794-88-7
Synonym(s):
5-Bromoanthranilic acid
CAS NO.：5794-88-7
Empirical Formula: C7H6BrNO2
Molecular Weight: 216.03
MDL number: MFCD00007823
EINECS: 227-338-3
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB28.00 | In Stock |
|
| 25G | RMB39.20 | In Stock |
|
| 100G | RMB138.40 | In Stock |
|
| 500g | RMB479.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 213-215 °C (lit.) |
| Boiling point: | 265.51°C (rough estimate) |
| Density | 1.6841 (rough estimate) |
| refractive index | 1.6120 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | Soluble in methanol and dimethyl sulfoxide. |
| pka | 4.55±0.10(Predicted) |
| form | Powder |
| color | Beige |
| Sensitive | Light Sensitive |
| Merck | 14,1405 |
| BRN | 639028 |
| InChI | InChI=1S/C7H6BrNO2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3H,9H2,(H,10,11) |
| InChIKey | CUKXRHLWPSBCTI-UHFFFAOYSA-N |
| SMILES | C(O)(=O)C1=CC(Br)=CC=C1N |
Description and Uses
It is used in the preparation of hepatitis C virus NS5b RNA polymerase inhibitors. Also used in the determination of cobalt, copper, nickel, and zinc.
Safety
| Symbol(GHS) |  GHS06 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H335 |
| Precautionary statements | P261-P264-P270-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37 |
| Safety Statements | 26-38-36/37 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| RTECS | CB2557670 |
| Hazard Note | Harmful |
| PackingGroup | 6.1/PG 3 |
| HS Code | 29224999 |
