A0674312
2-(Aminomethyl)-1-ethylpyrrolidine , 98% , 26116-12-1
CAS NO.：26116-12-1
Empirical Formula: C7H16N2
Molecular Weight: 128.22
MDL number: MFCD00003178
EINECS: 247-466-3
| Pack Size | Price | Stock | Quantity |
| 5ML | RMB23.20 | In Stock |
|
| 25ML | RMB56.00 | In Stock |
|
| 100ML | RMB208.00 | In Stock |
|
| 500ml | RMB712.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 58-60 °C16 mm Hg(lit.) |
| Density | 0.884 g/mL at 25 °C(lit.) |
| refractive index | n |
| Flash point: | 135 °F |
| storage temp. | 2-8°C |
| solubility | Chloroform (Sparingly), Methanol (Sparingly) |
| pka | 10.04±0.40(Predicted) |
| form | Liquid |
| color | Clear yellow |
| InChI | InChI=1S/C7H16N2/c1-2-9-5-3-4-7(9)6-8/h7H,2-6,8H2,1H3 |
| InChIKey | UNRBEYYLYRXYCG-UHFFFAOYSA-N |
| SMILES | N1(CC)CCCC1CN |
| LogP | 0.433 (est) |
| CAS DataBase Reference | 26116-12-1(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Pyrrolidinemethanamine, 1-ethyl-(26116-12-1) |
Description and Uses
2-(Aminomethyl)-1-ethylpyrrolidine is used as a reagent in the synthesis of S-Desethyl S-Methyl Amisulpride (D289595)
Safety
| Symbol(GHS) |   GHS02,GHS07 |
| Signal word | Warning |
| Hazard statements | H226-H315-H319-H335 |
| Precautionary statements | P210-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-20/21/22 |
| Safety Statements | 26-36 |
| RIDADR | UN 1993 3/PG 3 |
| WGK Germany | 3 |
| HazardClass | 3.2 |
| PackingGroup | III |
| HS Code | 29339900 |
