PRODUCT Properties
| Melting point: | 256-258 °C (subl.)(lit.) |
| Boiling point: | 211.78°C (rough estimate) |
| Density | 0.8709 (rough estimate) |
| refractive index | 1.4993 (estimate) |
| storage temp. | Sealed in dry,Room Temperature |
| solubility | methanol: 0.1 g/mL, clear |
| form | Crystalline Powder |
| color | White to off-white |
| BRN | 1210235 |
| InChI | InChI=1S/C10H14O/c11-10-8-2-6-1-7(4-8)5-9(10)3-6/h6-9H,1-5H2 |
| InChIKey | IYKFYARMMIESOX-UHFFFAOYSA-N |
| SMILES | C12CC3CC(CC(C3)C1=O)C2 |
| CAS DataBase Reference | 700-58-3(CAS DataBase Reference) |
| NIST Chemistry Reference | 2-Adamantanone(700-58-3) |
Description and Uses
2-Adamantanone was used in the synthesis of dispiro N-Boc-protected 1,2,4-trioxane and (+/-)-1-(adamantan-2-yl)-2-propanamine.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H402 |
| Precautionary statements | P273-P501 |
| Hazard Codes | Xi |
| Risk Statements | 52-36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 2 |
| RTECS | AU5018000 |
| Hazard Note | Irritant |
| HS Code | 29142900 |
