A0621212
5-Amino-2-methylpyridine , 98% , 3430-14-6
CAS NO.：3430-14-6
Empirical Formula: C6H8N2
Molecular Weight: 108.14
MDL number: MFCD00833389
EINECS: 625-232-5
| Pack Size | Price | Stock | Quantity |
| 250MG | RMB23.20 | In Stock |
|
| 1G | RMB27.20 | In Stock |
|
| 5G | RMB64.00 | In Stock |
|
| 25G | RMB243.20 | In Stock |
|
| 100G | RMB933.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 95-99°C |
| Boiling point: | 238.4±20.0 °C(Predicted) |
| Density | 1.068±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 6.89±0.10(Predicted) |
| color | Off-white to orange to brown |
| InChI | InChI=1S/C6H8N2/c1-5-2-3-6(7)4-8-5/h2-4H,7H2,1H3 |
| InChIKey | UENBBJXGCWILBM-UHFFFAOYSA-N |
| SMILES | C1=NC(C)=CC=C1N |
| LogP | 0.704 |
| CAS DataBase Reference | 3430-14-6(CAS DataBase Reference) |
Description and Uses
6-Methylpyridine-3-amine, is a heterocyclic building block used in the manufacture of various pharmaceutical compounds. It can be used for the synthesis of 2-aminoquinazoline derivatives, as a novel class of metabotropic glutamate receptor 5 negative allosteric modulators (mGluR5), leading toward a drug candidate for the treatment of l-DOPA induced dyskinesia.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xn,Xi,C |
| Risk Statements | 22-37/38-41-36/37/38-34-24/25 |
| Safety Statements | 26-36/39-45-36/37/39-36-27-36/37 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Harmful |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333999 |
