A0617112
1-Amino-1-cyclobutanecarboxylic acid , 97% , 22264-50-2
| Pack Size | Price | Stock | Quantity |
| 1G | RMB68.80 | In Stock |
|
| 5G | RMB217.60 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 261 °C (dec.)(lit.) |
| Boiling point: | 241.1±23.0 °C(Predicted) |
| Density | 1.290±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Powder |
| pka | 2.38±0.20(Predicted) |
| color | White |
| Water Solubility | Soluble to 100 mM in water. |
| InChI | InChI=1S/C5H9NO2/c6-5(4(7)8)2-1-3-5/h1-3,6H2,(H,7,8) |
| InChIKey | FVTVMQPGKVHSEY-UHFFFAOYSA-N |
| SMILES | C1(N)(C(O)=O)CCC1 |
Description and Uses
ACBC is an NMDA receptor antagonist acting at the glycine site. It acts as an agonist being an analog of glycine at the NMDA-glycine receptor site. This affects the signal transmission in the CNS.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H302-H315-H319-H335 |
| Precautionary statements | P301+P312+P330-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| WGK Germany | 3 |
| RTECS | GU1336000 |
| HazardClass | IRRITANT |
| HS Code | 2922498590 |
