A0611912
2-Amino-5-fluoropyridine , 97% , 21717-96-4
CAS NO.：21717-96-4
Empirical Formula: C5H5FN2
Molecular Weight: 112.11
MDL number: MFCD01861120
EINECS: 627-638-8
| Pack Size | Price | Stock | Quantity |
| 1G | RMB71.20 | In Stock |
|
| 5G | RMB231.20 | In Stock |
|
| 25G | RMB791.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 93-97 °C (lit.) |
| Boiling point: | 125 °C |
| Density | 1.257±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| solubility | soluble in Methanol |
| form | Powder |
| pka | 4.62±0.13(Predicted) |
| color | White to orange |
| BRN | 385938 |
| InChI | InChI=1S/C5H5FN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| InChIKey | YJTXQLYMECWULH-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(F)C=C1 |
| CAS DataBase Reference | 21717-96-4(CAS DataBase Reference) |
Description and Uses
2-Amino-5-fluoropyridine is used in chemical microarrays to identify ligands that binds pathogenic cells. Acts as a reagent in the preparation of heterocyclic compounds as integrase inhibiting antiviral agents.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi,C |
| Risk Statements | 36/37/38-34 |
| Safety Statements | 26-36-45-36/37/39-27 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | II |
| HS Code | 29333999 |
