A0611812
3-Amino-2-chloro-4-picoline , 98% , 133627-45-9
CAS NO.：133627-45-9
Empirical Formula: C6H7ClN2
Molecular Weight: 142.59
MDL number: MFCD00673152
EINECS: 603-756-5
| Pack Size | Price | Stock | Quantity |
| 1G | RMB23.20 | In Stock |
|
| 5G | RMB44.00 | In Stock |
|
| 25G | RMB79.20 | In Stock |
|
| 100G | RMB239.20 | In Stock |
|
| 500G | RMB1095.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 65-70 °C |
| Boiling point: | 283.3±35.0 °C(Predicted) |
| Density | 1.260±0.06 g/cm3(Predicted) |
| storage temp. | Keep in dark place,Inert atmosphere,2-8°C |
| solubility | Chloroform, Ethanol |
| pka | 3.22±0.10(Predicted) |
| form | Crystals |
| color | Off White |
| InChI | InChI=1S/C6H7ClN2/c1-4-2-3-9-6(7)5(4)8/h2-3H,8H2,1H3 |
| InChIKey | UOBCYTOUXLAABU-UHFFFAOYSA-N |
| SMILES | C1(Cl)=NC=CC(C)=C1N |
| CAS DataBase Reference | 133627-45-9(CAS DataBase Reference) |
Description and Uses
3-Amino-2-chloro-4-methylpyridine, also known as CAPIC, is a key intermediate in the production of nevirapine, a non-nucleosidic reverse transcriptase inhibitor that has been established to be clinically useful for the treatment of infection by HIV-1.
Safety
| Symbol(GHS) |   GHS05,GHS07 |
| Signal word | Danger |
| Hazard statements | H302-H315-H318-H335 |
| Precautionary statements | P280-P301+P312+P330-P302+P352-P305+P351+P338+P310 |
| Hazard Codes | Xi,Xn |
| Risk Statements | 36/37/38-41-37/38-22 |
| Safety Statements | 26-36/37/39-36-39 |
| RIDADR | UN2811 |
| WGK Germany | 3 |
| Hazard Note | Irritant |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29333990 |
