A0607912
2-Amino-5-bromopyridine , 98% , 1072-97-5
CAS NO.：1072-97-5
Empirical Formula: C5H5BrN2
Molecular Weight: 173.01
MDL number: MFCD00006323
EINECS: 214-019-9
| Pack Size | Price | Stock | Quantity |
| 5G | RMB23.20 | In Stock |
|
| 25G | RMB43.20 | In Stock |
|
| 100G | RMB98.40 | In Stock |
|
| 500G | RMB400.00 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 133-138 °C (lit.) |
| Boiling point: | 230.9±20.0 °C(Predicted) |
| Density | 1.6065 (rough estimate) |
| refractive index | 1.5182 (estimate) |
| storage temp. | Keep in dark place,Inert atmosphere,Room temperature |
| form | Crystalline Powder |
| pka | 4.65±0.13(Predicted) |
| color | White to beige |
| Water Solubility | Soluble in methanol, chloroform, ethyl acetate. Slightly soluble in water. |
| BRN | 108737 |
| InChI | InChI=1S/C5H5BrN2/c6-4-1-2-5(7)8-3-4/h1-3H,(H2,7,8) |
| InChIKey | WGOLHUGPTDEKCF-UHFFFAOYSA-N |
| SMILES | C1(N)=NC=C(Br)C=C1 |
| CAS DataBase Reference | 1072-97-5(CAS DataBase Reference) |
| EPA Substance Registry System | 2-Amino-5-bromopyridine (1072-97-5) |
Description and Uses
2-Amino-5-bromopyridine is used for the synthesis of polycyclic azaarenes.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xn,Xi |
| Risk Statements | 22-36/37/38 |
| Safety Statements | 26-36 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 2 |
| F | 10 |
| HazardClass | IRRITANT |
| HS Code | 29333999 |
