A0605412
4-Acetyl-biphenyl , 98% , 92-91-1
Synonym(s):
4-Biphenyl methyl ketone;4-Phenylacetophenone
CAS NO.：92-91-1
Empirical Formula: C14H12O
Molecular Weight: 196.24
MDL number: MFCD00008749
EINECS: 202-202-6
| Pack Size | Price | Stock | Quantity |
| 25G | RMB38.40 | In Stock |
|
| 100G | RMB100.80 | In Stock |
|
| 500G | RMB351.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 152-155 °C(lit.) |
| Boiling point: | 325-327 °C |
| Density | 1.2510 |
| refractive index | 1.5920 (estimate) |
| Flash point: | 168°C/8mm |
| storage temp. | 2-8°C |
| solubility | chloroform: soluble10mg/200microlitres, clear, colorless to faintly yellow |
| form | Solid |
| color | White to Green to Brown |
| Water Solubility | insoluble |
| BRN | 1101615 |
| InChI | InChI=1S/C14H12O/c1-11(15)12-7-9-14(10-8-12)13-5-3-2-4-6-13/h2-10H,1H3 |
| InChIKey | QCZZSANNLWPGEA-UHFFFAOYSA-N |
| SMILES | C(=O)(C1=CC=C(C2=CC=CC=C2)C=C1)C |
| CAS DataBase Reference | 92-91-1(CAS DataBase Reference) |
| NIST Chemistry Reference | Ethanone, 1-[1,1'-biphenyl]-4-yl-(92-91-1) |
| EPA Substance Registry System | Ethanone, 1-[1,1'-biphenyl]-4-yl- (92-91-1) |
Description and Uses
4-Acetylbiphenyl was used to study the inactivation of 7-ethoxy-4-trifluoromethylcoumarin O-deethylase activity by various arylalkynes. It may be used in the synthesis of Schiffs base.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319 |
| Precautionary statements | P264-P280-P302+P352-P305+P351+P338-P332+P313-P337+P313 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 22-24/25-36-26 |
| WGK Germany | 3 |
| RTECS | DI0887010 |
| TSCA | Yes |
| HS Code | 29143900 |
