A0577156
1-Butyl-3-methylimidazoliumchloride , 98% , 79917-90-1
Synonym(s):
N-Butyl-N′-methylimidazolium chloride;1-Methyl-3-butylimidazolium chloride;BMIMCl
CAS NO.：79917-90-1
Empirical Formula: C8H15ClN2
Molecular Weight: 174.67
MDL number: MFCD03095425
EINECS: 460-120-8
| Pack Size | Price | Stock | Quantity |
| 10g | RMB31.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | ~70 °C |
| Density | d25 1.08 (dried) |
| Flash point: | 192 °C |
| storage temp. | Inert atmosphere,Room Temperature |
| solubility | DMSO (Slightly), Methanol (Sparingly) |
| form | Mass |
| color | Cream to yellow |
| Water Solubility | Soluble in acetone, acetonitrile, hot ethyl acetate, isopropyl alcohol, methylene chloride and methanol. Insoluble in water, hexane and toluene, |
| Sensitive | Hygroscopic |
| BRN | 6449277 |
| Stability: | hygroscopic |
| InChI | InChI=1S/C8H15N2.ClH/c1-3-4-5-10-7-6-9(2)8-10;/h6-8H,3-5H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | FHDQNOXQSTVAIC-UHFFFAOYSA-M |
| SMILES | N1(CCCC)C=C[N+](C)=C1.[Cl-] |
Description and Uses
1-Butyl-3-methylimidazolium chloride in combination with aluminium chloride forms an organoaluminate molten salt, which can act as an acidic catalyst for the alkylation of isobutane with 2-butene.
Safety
| Symbol(GHS) |   GHS06,GHS09 |
| Signal word | Danger |
| Hazard statements | H301-H315-H319-H411 |
| Precautionary statements | P264-P270-P273-P301+P310-P302+P352-P305+P351+P338 |
| Hazard Codes | T,N |
| Risk Statements | 25-36/37/38-51/53-36/38 |
| Safety Statements | 26-45-61-22 |
| RIDADR | UN 2811 6.1/PG 3 |
| WGK Germany | 3 |
| F | 3-10-21 |
| HazardClass | 6.1 |
| PackingGroup | III |
| HS Code | 29332900 |
