A0558650
1,1'-Thiocarbonyldi-2(1H)-pyridone , ≥95% , 102368-13-8
| Pack Size | Price | Stock | Quantity |
| 1g | RMB51.20 | In Stock |
|
| 250mg | RMB79.20 | In Stock |
|
| 5g | RMB221.60 | In Stock |
|
| 25g | RMB860.80 | In Stock |
|
| 100g | RMB3180.80 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Melting point: | 163-166 °C(lit.) |
| Boiling point: | 385.2±25.0 °C(Predicted) |
| Density | 1.485 |
| storage temp. | Inert atmosphere,Store in freezer, under -20°C |
| pka | -1.70±0.23(Predicted) |
| form | powder to crystal |
| color | Light yellow to Brown |
| InChI | InChI=1S/C11H8N2O2S/c14-9-5-1-3-7-12(9)11(16)13-8-4-2-6-10(13)15/h1-8H |
| InChIKey | KXMMNJQMGILZDB-UHFFFAOYSA-N |
| SMILES | C(N1C(=O)C=CC=C1)(N1C(=O)C=CC=C1)=S |
Description and Uses
1,1'-Thiocarbonyldi-2(1H)-pyridone is used in the preparation of thio-analogs of thioureas, sulforaphane and 2-furan-2-yl-3-hydroxy-6-isothiocyanato-chromen-4-one. It is involved in the preparation of norbiotinamine and its reactive derivatives such as isothiocyanates.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P264-P271-P280-P302+P352-P305+P351+P338 |
| Hazard Codes | Xi |
| Risk Statements | 36/37/38 |
| Safety Statements | 26-37/39 |
| WGK Germany | 3 |
| HS Code | 2933.79.8500 |
