A0492750
1,1,1,2,2,3,4,5,5,5-Decafluoro-3-methoxy-4-(trifluoromethyl)pentane , ≥98% , 132182-92-4
| Pack Size | Price | Stock | Quantity |
| 25g | RMB141.60 | In Stock |
|
| 100g | RMB417.60 | In Stock |
|
| 500g | RMB1491.20 | In Stock |
|
| others | Enquire |
Update time: 2022-07-08
PRODUCT Properties
| Boiling point: | 100 °C |
| Density | 1.67 |
| vapor pressure | 62.5hPa at 20℃ |
| Water Solubility | Insoluble in water |
| form | clear liquid |
| color | Colorless to Almost colorless |
| Specific Gravity | 1.67 |
| InChI | InChI=1S/C7H3F13O/c1-21-4(11,3(9,10)7(18,19)20)2(8,5(12,13)14)6(15,16)17/h1H3 |
| InChIKey | QKAGYSDHEJITFV-UHFFFAOYSA-N |
| SMILES | C(F)(F)(F)C(F)(F)C(F)(OC)C(F)(C(F)(F)F)C(F)(F)F |
| LogP | 4.3 at 23.4℃ |
Description and Uses
1,1,1,2,2,3,4,5,5,5-Decafluoro-3-methoxy-4-(trifluoromethyl)pentane is used in preparation method of isolated Hydrofluoroether.
Safety
| Symbol(GHS) |  GHS07 |
| Signal word | Warning |
| Hazard statements | H315-H319-H335 |
| Precautionary statements | P261-P271-P280 |
| HS Code | 2914199090 |
